C24H14BrCl3FNO3S — CID 4091796
5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4091796) has the molecular formula C24H14BrCl3FNO3S and a molecular weight of 601.71 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4091796 |
| Molecular Formula | C24H14BrCl3FNO3S |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 598.89 |
| IUPAC Name | 5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-[(2-chloro-6-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(OCc3ccc(Cl)cc3Cl)c(Br)c2)C(=O)N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C24H14BrCl3FNO3S/c25-17-8-13(4-7-21(17)33-12-14-5-6-15(26)10-19(14)28)9-22-23(31)30(24(32)34-22)11-16-18(27)2-1-3-20(16)29/h1-10H,11-12H2 |
| InChIKey | QDAYQDXYDGGJBJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|