About ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate
ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate (PubChem CID 4091905) has the molecular formula C19H16Cl2N2O2
and a molecular weight of 375.26 g/mol. Its IUPAC name is ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate |
| PubChem CID | 4091905 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate |
| SMILES | CCOC(=O)C(C#N)=CC=C1C=CN(Cc2ccc(Cl)cc2Cl)C=C1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-2-25-19(24)15(12-22)4-3-14-7-9-23(10-8-14)13-16-5-6-17(20)11-18(16)21/h3-11H,2,13H2,1H3 |
| InChIKey | BSIHOFJISAVVLE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate?
The IUPAC name of ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate (CID 4091905) is ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate.
What is the SMILES notation for ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate?
The canonical SMILES for ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate is CCOC(=O)C(C#N)=CC=C1C=CN(Cc2ccc(Cl)cc2Cl)C=C1.
What is the InChIKey of ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate?
The InChIKey is BSIHOFJISAVVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N2O2/c1-2-25-19(24)15(12-22)4-3-14-7-9-23(10-8-14)13-16-5-6-17(20)11-18(16)21/h3-11H,2,13H2,1H3.
What are the key properties of ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate?
ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate has a molecular weight of 375.26 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-4-[1-[(2,4-dichlorophenyl)methyl]-4-pyridinylidene]but-2-enoate is sourced from PubChem (CID 4091905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).