C20H17N3O2 — CID 40921065
[(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(1-benzofuran-2-yl)methanone (PubChem CID 40921065) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is [(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(1-benzofuran-2-yl)methanone.
| Compound Name | [(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 40921065 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(2S)-2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]-(1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCC[C@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H17N3O2/c24-20(18-12-13-6-1-4-10-17(13)25-18)23-11-5-9-16(23)19-21-14-7-2-3-8-15(14)22-19/h1-4,6-8,10,12,16H,5,9,11H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | HUHIRPOFQCQFJO-INIZCTEOSA-N |
| XLogP | 4.29 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |