C25H20BrClN2O2 — CID 40922510
(5R,10bS)-9-bromo-5-(4-chlorophenyl)-2-(4-prop-2-enoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 40922510) has the molecular formula C25H20BrClN2O2 and a molecular weight of 495.80 g/mol. Its IUPAC name is (5R,10bS)-9-bromo-5-(4-chlorophenyl)-2-(4-prop-2-enoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5R,10bS)-9-bromo-5-(4-chlorophenyl)-2-(4-prop-2-enoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 40922510 |
| Molecular Formula | C25H20BrClN2O2 |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | (5R,10bS)-9-bromo-5-(4-chlorophenyl)-2-(4-prop-2-enoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | C=CCOc1ccc(C2=NN3[C@@H](c4ccc(Cl)cc4)Oc4ccc(Br)cc4[C@@H]3C2)cc1 |
| InChI | InChI=1S/C25H20BrClN2O2/c1-2-13-30-20-10-5-16(6-11-20)22-15-23-21-14-18(26)7-12-24(21)31-25(29(23)28-22)17-3-8-19(27)9-4-17/h2-12,14,23,25H,1,13,15H2/t23-,25+/m0/s1 |
| InChIKey | QUEWHXFEFAPEIN-UKILVPOCSA-N |
| XLogP | 6.91 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|