C30H34BrNO7 — CID 4092349
3-[2-[5-bromo-6-hydroxy-6-(6-hydroxyhexyl)-3-oxopyran-2-yl]-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 4092349) has the molecular formula C30H34BrNO7 and a molecular weight of 600.51 g/mol. Its IUPAC name is 3-[2-[5-bromo-6-hydroxy-6-(6-hydroxyhexyl)-3-oxopyran-2-yl]-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[5-bromo-6-hydroxy-6-(6-hydroxyhexyl)-3-oxopyran-2-yl]-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 4092349 |
| Molecular Formula | C30H34BrNO7 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 3-[2-[5-bromo-6-hydroxy-6-(6-hydroxyhexyl)-3-oxopyran-2-yl]-3-phenylpropanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1C(c2ccccc2)OC(=O)N1C(=O)C(Cc1ccccc1)C1OC(O)(CCCCCCO)C(Br)=CC1=O |
| InChI | InChI=1S/C30H34BrNO7/c1-20-26(22-14-8-5-9-15-22)38-29(36)32(20)28(35)23(18-21-12-6-4-7-13-21)27-24(34)19-25(31)30(37,39-27)16-10-2-3-11-17-33/h4-9,12-15,19-20,23,26-27,33,37H,2-3,10-11,16-18H2,1H3 |
| InChIKey | OZBTWZOBKXOJJN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|