About (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate
(2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate (PubChem CID 4092397) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate.
Molecular Properties
| Compound Name | (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate |
| PubChem CID | 4092397 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(N(C)C(=O)Oc2cccc3ccc(C)nc23)cc1 |
| InChI | InChI=1S/C19H18N2O2/c1-13-7-11-16(12-8-13)21(3)19(22)23-17-6-4-5-15-10-9-14(2)20-18(15)17/h4-12H,1-3H3 |
| InChIKey | MWIGRGMJHVFEFD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate?
The IUPAC name of (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate (CID 4092397) is (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate.
What is the SMILES notation for (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate?
The canonical SMILES for (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate is Cc1ccc(N(C)C(=O)Oc2cccc3ccc(C)nc23)cc1.
What is the InChIKey of (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate?
The InChIKey is MWIGRGMJHVFEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-13-7-11-16(12-8-13)21(3)19(22)23-17-6-4-5-15-10-9-14(2)20-18(15)17/h4-12H,1-3H3.
What are the key properties of (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate?
(2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate has a molecular weight of 306.37 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylquinolin-8-yl) N-methyl-N-(4-methylphenyl)carbamate is sourced from PubChem (CID 4092397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).