C18H19N3O — CID 4092454
N-(benzylideneamino)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide (PubChem CID 4092454) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(benzylideneamino)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide.
| Compound Name | N-(benzylideneamino)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 4092454 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(benzylideneamino)-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide |
| SMILES | O=C(CN1CCCc2ccccc21)NN=Cc1ccccc1 |
| InChI | InChI=1S/C18H19N3O/c22-18(20-19-13-15-7-2-1-3-8-15)14-21-12-6-10-16-9-4-5-11-17(16)21/h1-5,7-9,11,13H,6,10,12,14H2,(H,20,22) |
| InChIKey | QLCMOIXVRLCDSZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|