About 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol
2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol (PubChem CID 4092564) has the molecular formula C13H8ClI2NO
and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol.
Molecular Properties
| Compound Name | 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol |
| PubChem CID | 4092564 |
| Molecular Formula | C13H8ClI2NO |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.84 |
| IUPAC Name | 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H8ClI2NO/c14-9-2-1-3-11(5-9)17-7-8-4-10(15)6-12(16)13(8)18/h1-7,18H/b17-7+ |
| InChIKey | DGCXDRCRUCGQBK-REZTVBANSA-N |
| XLogP | 5.01 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol?
The IUPAC name of 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol (CID 4092564) is 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol.
What is the SMILES notation for 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol?
The canonical SMILES for 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol is Oc1c(I)cc(I)cc1/C=N/c1cccc(Cl)c1.
What is the InChIKey of 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol?
The InChIKey is DGCXDRCRUCGQBK-REZTVBANSA-N. The full InChI is InChI=1S/C13H8ClI2NO/c14-9-2-1-3-11(5-9)17-7-8-4-10(15)6-12(16)13(8)18/h1-7,18H/b17-7+.
What are the key properties of 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol?
2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol has a molecular weight of 483.47 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chlorophenyl)iminomethyl]-4,6-diiodophenol is sourced from PubChem (CID 4092564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).