C20H17F2N3O2 — CID 4092636
5-[2-(3,5-difluorophenyl)acetyl]-11-methyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one (PubChem CID 4092636) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is 5-[2-(3,5-difluorophenyl)acetyl]-11-methyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one.
| Compound Name | 5-[2-(3,5-difluorophenyl)acetyl]-11-methyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 4092636 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-[2-(3,5-difluorophenyl)acetyl]-11-methyl-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
| SMILES | Cc1cccn2c(=O)c3c(nc12)CCN(C(=O)Cc1cc(F)cc(F)c1)C3 |
| InChI | InChI=1S/C20H17F2N3O2/c1-12-3-2-5-25-19(12)23-17-4-6-24(11-16(17)20(25)27)18(26)9-13-7-14(21)10-15(22)8-13/h2-3,5,7-8,10H,4,6,9,11H2,1H3 |
| InChIKey | LTHZMBPFYHDFBA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |