About 2,3-dichloro-6,7-dimethylquinoxaline
2,3-dichloro-6,7-dimethylquinoxaline (PubChem CID 4092647) has the molecular formula C10H8Cl2N2
and a molecular weight of 227.09 g/mol. Its IUPAC name is 2,3-dichloro-6,7-dimethylquinoxaline.
Molecular Properties
| Compound Name | 2,3-dichloro-6,7-dimethylquinoxaline |
| PubChem CID | 4092647 |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2,3-dichloro-6,7-dimethylquinoxaline |
| SMILES | Cc1cc2nc(Cl)c(Cl)nc2cc1C |
| InChI | InChI=1S/C10H8Cl2N2/c1-5-3-7-8(4-6(5)2)14-10(12)9(11)13-7/h3-4H,1-2H3 |
| InChIKey | NKBSIBTVPNHSIK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dichloro-6,7-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-6,7-dimethylquinoxaline?
The IUPAC name of 2,3-dichloro-6,7-dimethylquinoxaline (CID 4092647) is 2,3-dichloro-6,7-dimethylquinoxaline.
What is the SMILES notation for 2,3-dichloro-6,7-dimethylquinoxaline?
The canonical SMILES for 2,3-dichloro-6,7-dimethylquinoxaline is Cc1cc2nc(Cl)c(Cl)nc2cc1C.
What is the InChIKey of 2,3-dichloro-6,7-dimethylquinoxaline?
The InChIKey is NKBSIBTVPNHSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2/c1-5-3-7-8(4-6(5)2)14-10(12)9(11)13-7/h3-4H,1-2H3.
What are the key properties of 2,3-dichloro-6,7-dimethylquinoxaline?
2,3-dichloro-6,7-dimethylquinoxaline has a molecular weight of 227.09 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-6,7-dimethylquinoxaline is sourced from PubChem (CID 4092647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).