C24H32N4O4S — CID 40927570
(5R)-5-[[2-[4-(azepane-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfanylmethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 40927570) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is (5R)-5-[[2-[4-(azepane-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfanylmethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[2-[4-(azepane-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfanylmethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40927570 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (5R)-5-[[2-[4-(azepane-1-carbonyl)piperidine-1-carbonyl]phenyl]sulfanylmethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(CSc2ccccc2C(=O)N2CCC(C(=O)N3CCCCCC3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H32N4O4S/c1-24(22(31)25-23(32)26-24)16-33-19-9-5-4-8-18(19)21(30)28-14-10-17(11-15-28)20(29)27-12-6-2-3-7-13-27/h4-5,8-9,17H,2-3,6-7,10-16H2,1H3,(H2,25,26,31,32)/t24-/m0/s1 |
| InChIKey | NGIKHMRZFVONFU-DEOSSOPVSA-N |
| XLogP | 2.63 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|