C26H22N2O6S — CID 40928058
7-[2-[(3S)-3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 40928058) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is 7-[2-[(3S)-3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 7-[2-[(3S)-3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 40928058 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 7-[2-[(3S)-3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | COc1ccc([C@@H]2CC(c3cccs3)=NN2C(=O)COc2ccc3ccc(=O)oc3c2)cc1OC |
| InChI | InChI=1S/C26H22N2O6S/c1-31-21-9-6-17(12-23(21)32-2)20-14-19(24-4-3-11-35-24)27-28(20)25(29)15-33-18-8-5-16-7-10-26(30)34-22(16)13-18/h3-13,20H,14-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | BGAFGTBQIXDYNU-FQEVSTJZSA-N |
| XLogP | 4.63 |
| TPSA | 90.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|