C27H24Cl2N2O4 — CID 40928273
(5S)-5-(3,4-dichlorophenyl)-4-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 40928273) has the molecular formula C27H24Cl2N2O4 and a molecular weight of 511.41 g/mol. Its IUPAC name is (5S)-5-(3,4-dichlorophenyl)-4-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(3,4-dichlorophenyl)-4-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40928273 |
| Molecular Formula | C27H24Cl2N2O4 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (5S)-5-(3,4-dichlorophenyl)-4-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(OC(C)C)ccc1C(O)=C1C(=O)C(=O)N(Cc2cccnc2)[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H24Cl2N2O4/c1-15(2)35-19-7-8-20(16(3)11-19)25(32)23-24(18-6-9-21(28)22(29)12-18)31(27(34)26(23)33)14-17-5-4-10-30-13-17/h4-13,15,24,32H,14H2,1-3H3/t24-/m0/s1 |
| InChIKey | NTKLXNZVCBJUFY-DEOSSOPVSA-N |
| XLogP | 6.11 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|