About 2-prop-2-enylguanidine
2-prop-2-enylguanidine (PubChem CID 4092846) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is 2-prop-2-enylguanidine.
Molecular Properties
| Compound Name | 2-prop-2-enylguanidine |
| PubChem CID | 4092846 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 2-prop-2-enylguanidine |
| SMILES | C=CCN=C(N)N |
| InChI | InChI=1S/C4H9N3/c1-2-3-7-4(5)6/h2H,1,3H2,(H4,5,6,7) |
| InChIKey | WUEZQZHHXYEAQM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylguanidine?
The IUPAC name of 2-prop-2-enylguanidine (CID 4092846) is 2-prop-2-enylguanidine.
What is the SMILES notation for 2-prop-2-enylguanidine?
The canonical SMILES for 2-prop-2-enylguanidine is C=CCN=C(N)N.
What is the InChIKey of 2-prop-2-enylguanidine?
The InChIKey is WUEZQZHHXYEAQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3/c1-2-3-7-4(5)6/h2H,1,3H2,(H4,5,6,7).
What are the key properties of 2-prop-2-enylguanidine?
2-prop-2-enylguanidine has a molecular weight of 99.14 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylguanidine is sourced from PubChem (CID 4092846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).