C21H22ClFN6O2S — CID 40935203
N'-[2-[[4-(4-chlorophenyl)-5-[(1R)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide (PubChem CID 40935203) has the molecular formula C21H22ClFN6O2S and a molecular weight of 476.97 g/mol. Its IUPAC name is N'-[2-[[4-(4-chlorophenyl)-5-[(1R)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[[4-(4-chlorophenyl)-5-[(1R)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 40935203 |
| Molecular Formula | C21H22ClFN6O2S |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N'-[2-[[4-(4-chlorophenyl)-5-[(1R)-1-(dimethylamino)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
| SMILES | C[C@H](c1nnc(SCC(=O)NNC(=O)c2ccc(F)cc2)n1-c1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C21H22ClFN6O2S/c1-13(28(2)3)19-25-27-21(29(19)17-10-6-15(22)7-11-17)32-12-18(30)24-26-20(31)14-4-8-16(23)9-5-14/h4-11,13H,12H2,1-3H3,(H,24,30)(H,26,31)/t13-/m1/s1 |
| InChIKey | ZEJARIBSWHWXIE-CYBMUJFWSA-N |
| XLogP | 3.24 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|