C29H30N2O4 — CID 40936868
(10R,11S,15S,16S)-13-(4-acetylphenyl)-16-(2,2-dimethylpropanoyl)-5,8-dimethyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 40936868) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (10R,11S,15S,16S)-13-(4-acetylphenyl)-16-(2,2-dimethylpropanoyl)-5,8-dimethyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11S,15S,16S)-13-(4-acetylphenyl)-16-(2,2-dimethylpropanoyl)-5,8-dimethyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 40936868 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (10R,11S,15S,16S)-13-(4-acetylphenyl)-16-(2,2-dimethylpropanoyl)-5,8-dimethyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3[C@H](C2=O)[C@@H](C(=O)C(C)(C)C)N2c4ccc(C)cc4C(C)=C[C@H]32)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-15-7-12-21-20(13-15)16(2)14-22-23-24(25(31(21)22)26(33)29(4,5)6)28(35)30(27(23)34)19-10-8-18(9-11-19)17(3)32/h7-14,22-25H,1-6H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | VHMHDMNGCKSVOH-NGSHPTGOSA-N |
| XLogP | 4.59 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|