C35H38N5O2P — CID 4093710
N-[(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-[(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanyl]-N-methylmethanamine (PubChem CID 4093710) has the molecular formula C35H38N5O2P and a molecular weight of 591.70 g/mol. Its IUPAC name is N-[(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-[(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanyl]-N-methylmethanamine.
| Compound Name | N-[(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-[(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 4093710 |
| Molecular Formula | C35H38N5O2P |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | N-[(9-ethylcarbazol-3-yl)-(2-methyl-5-nitrophenyl)imino-[(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphanyl]-N-methylmethanamine |
| SMILES | CCn1c2ccccc2c2cc(P(C=C3N(C)c4ccccc4C3(C)C)(=Nc3cc([N+](=O)[O-])ccc3C)N(C)C)ccc21 |
| InChI | InChI=1S/C35H38N5O2P/c1-8-39-31-15-11-9-13-27(31)28-22-26(19-20-32(28)39)43(37(5)6,36-30-21-25(40(41)42)18-17-24(30)2)23-34-35(3,4)29-14-10-12-16-33(29)38(34)7/h9-23H,8H2,1-7H3 |
| InChIKey | KDJUZEZZCIOQLZ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|