C28H20ClFN2O3 — CID 40937193
(1'R,2'S,3R,3'aR)-1'-acetyl-2'-(4-chlorobenzoyl)-7'-fluorospiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 40937193) has the molecular formula C28H20ClFN2O3 and a molecular weight of 486.93 g/mol. Its IUPAC name is (1'R,2'S,3R,3'aR)-1'-acetyl-2'-(4-chlorobenzoyl)-7'-fluorospiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'R,2'S,3R,3'aR)-1'-acetyl-2'-(4-chlorobenzoyl)-7'-fluorospiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 40937193 |
| Molecular Formula | C28H20ClFN2O3 |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | (1'R,2'S,3R,3'aR)-1'-acetyl-2'-(4-chlorobenzoyl)-7'-fluorospiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC(=O)[C@H]1[C@@H](C(=O)c2ccc(Cl)cc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3cc(F)ccc3N12 |
| InChI | InChI=1S/C28H20ClFN2O3/c1-15(33)25-24(26(34)16-6-9-18(29)10-7-16)28(20-4-2-3-5-21(20)31-27(28)35)23-13-8-17-14-19(30)11-12-22(17)32(23)25/h2-14,23-25H,1H3,(H,31,35)/t23-,24+,25+,28-/m1/s1 |
| InChIKey | JGBAEQZSGKAWOY-MEWSVHOLSA-N |
| XLogP | 5.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |