C20H23N3O2S — CID 40939109
4-[(1R,2R)-1-hydroxy-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]propyl]phenol (PubChem CID 40939109) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[(1R,2R)-1-hydroxy-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]propyl]phenol.
| Compound Name | 4-[(1R,2R)-1-hydroxy-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]propyl]phenol |
|---|---|
| PubChem CID | 40939109 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[(1R,2R)-1-hydroxy-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]propyl]phenol |
| SMILES | C[C@@H]1CCc2c(sc3ncnc(N[C@H](C)C(O)c4ccc(O)cc4)c23)C1 |
| InChI | InChI=1S/C20H23N3O2S/c1-11-3-8-15-16(9-11)26-20-17(15)19(21-10-22-20)23-12(2)18(25)13-4-6-14(24)7-5-13/h4-7,10-12,18,24-25H,3,8-9H2,1-2H3,(H,21,22,23)/t11-,12-,18?/m1/s1 |
| InChIKey | KWKNZEJEOCTRQA-FRCFAINYSA-N |
| XLogP | 4.06 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |