C23H23FN2O3S — CID 4094024
5-(benzylsulfamoyl)-N-(2-ethyl-6-methylphenyl)-2-fluorobenzamide (PubChem CID 4094024) has the molecular formula C23H23FN2O3S and a molecular weight of 426.51 g/mol. Its IUPAC name is 5-(benzylsulfamoyl)-N-(2-ethyl-6-methylphenyl)-2-fluorobenzamide.
| Compound Name | 5-(benzylsulfamoyl)-N-(2-ethyl-6-methylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 4094024 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 5-(benzylsulfamoyl)-N-(2-ethyl-6-methylphenyl)-2-fluorobenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cc(S(=O)(=O)NCc2ccccc2)ccc1F |
| InChI | InChI=1S/C23H23FN2O3S/c1-3-18-11-7-8-16(2)22(18)26-23(27)20-14-19(12-13-21(20)24)30(28,29)25-15-17-9-5-4-6-10-17/h4-14,25H,3,15H2,1-2H3,(H,26,27) |
| InChIKey | AVOBNASLIKUHPJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |