About 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium
4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium (PubChem CID 4094071) has the molecular formula C19H24BrS+
and a molecular weight of 364.37 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium |
| PubChem CID | 4094071 |
| Molecular Formula | C19H24BrS+ |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium |
| SMILES | CC(C)(C)c1cc(-c2ccc(Br)cc2)cc(C(C)(C)C)[s+]1 |
| InChI | InChI=1S/C19H24BrS/c1-18(2,3)16-11-14(12-17(21-16)19(4,5)6)13-7-9-15(20)10-8-13/h7-12H,1-6H3/q+1 |
| InChIKey | PFNUCFRVHUJPNO-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium?
The IUPAC name of 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium (CID 4094071) is 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium.
What is the SMILES notation for 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium?
The canonical SMILES for 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium is CC(C)(C)c1cc(-c2ccc(Br)cc2)cc(C(C)(C)C)[s+]1.
What is the InChIKey of 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium?
The InChIKey is PFNUCFRVHUJPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24BrS/c1-18(2,3)16-11-14(12-17(21-16)19(4,5)6)13-7-9-15(20)10-8-13/h7-12H,1-6H3/q+1.
What are the key properties of 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium?
4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium has a molecular weight of 364.37 g/mol, XLogP of 7.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2,6-ditert-butylthiopyrylium is sourced from PubChem (CID 4094071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).