C25H27FN4O3S — CID 4094145
N-(2-ethyl-6-methylphenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 4094145) has the molecular formula C25H27FN4O3S and a molecular weight of 482.58 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 4094145 |
| Molecular Formula | C25H27FN4O3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-fluoro-5-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cc(S(=O)(=O)N2CCN(c3ccccn3)CC2)ccc1F |
| InChI | InChI=1S/C25H27FN4O3S/c1-3-19-8-6-7-18(2)24(19)28-25(31)21-17-20(10-11-22(21)26)34(32,33)30-15-13-29(14-16-30)23-9-4-5-12-27-23/h4-12,17H,3,13-16H2,1-2H3,(H,28,31) |
| InChIKey | RXJDFRNSHHIUQL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |