C24H21N3O6 — CID 4094680
2,4,6-tris(2-methoxyphenoxy)-1,3,5-triazine (PubChem CID 4094680) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2,4,6-tris(2-methoxyphenoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2-methoxyphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 4094680 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2,4,6-tris(2-methoxyphenoxy)-1,3,5-triazine |
| SMILES | COc1ccccc1Oc1nc(Oc2ccccc2OC)nc(Oc2ccccc2OC)n1 |
| InChI | InChI=1S/C24H21N3O6/c1-28-16-10-4-7-13-19(16)31-22-25-23(32-20-14-8-5-11-17(20)29-2)27-24(26-22)33-21-15-9-6-12-18(21)30-3/h4-15H,1-3H3 |
| InChIKey | VWYNRKLJUNWLRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |