C23H22N2O3 — CID 40946919
N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-naphthalen-2-yloxyacetamide (PubChem CID 40946919) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 40946919 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-2-naphthalen-2-yloxyacetamide |
| SMILES | CCN1C(=O)CCc2cc(NC(=O)COc3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C23H22N2O3/c1-2-25-21-11-9-19(13-18(21)8-12-23(25)27)24-22(26)15-28-20-10-7-16-5-3-4-6-17(16)14-20/h3-7,9-11,13-14H,2,8,12,15H2,1H3,(H,24,26) |
| InChIKey | IXBSFIKFAGZDJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |