About N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide
N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide (PubChem CID 40946997) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide.
Molecular Properties
| Compound Name | N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
| PubChem CID | 40946997 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)C(=O)NCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H17N3O3/c1-21-14-10-6-5-9-13(14)15(18(21)24)20-17(23)16(22)19-11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | ZAEOAXCNDWQKKI-OAHLLOKOSA-N |
| XLogP | 1.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide?
The IUPAC name of N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide (CID 40946997) is N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide.
What is the SMILES notation for N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide?
The canonical SMILES for N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide is CN1C(=O)[C@H](NC(=O)C(=O)NCc2ccccc2)c2ccccc21.
What is the InChIKey of N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide?
The InChIKey is ZAEOAXCNDWQKKI-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-21-14-10-6-5-9-13(14)15(18(21)24)20-17(23)16(22)19-11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3,(H,19,22)(H,20,23)/t15-/m1/s1.
What are the key properties of N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide?
N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide has a molecular weight of 323.35 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-[(3R)-1-methyl-2-oxo-3H-indol-3-yl]oxamide is sourced from PubChem (CID 40946997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).