C21H24F4N2O2S — CID 40950737
N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 40950737) has the molecular formula C21H24F4N2O2S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 40950737 |
| Molecular Formula | C21H24F4N2O2S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c(F)c1F |
| InChI | InChI=1S/C21H24F4N2O2S/c1-9(21-6-10-3-11(7-21)5-12(4-10)8-21)26-20(30)27-19(28)13-14(22)16(24)18(29-2)17(25)15(13)23/h9-12H,3-8H2,1-2H3,(H2,26,27,28,30)/t9-,10?,11?,12?,21?/m1/s1 |
| InChIKey | DPRIMAPBPKZYDM-CRURNWASSA-N |
| XLogP | 4.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|