C24H20N4O4S2 — CID 4095185
6-benzyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 4095185) has the molecular formula C24H20N4O4S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 6-benzyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 6-benzyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4095185 |
| Molecular Formula | C24H20N4O4S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 6-benzyl-2-[(5-nitro-1-benzothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H20N4O4S2/c25-22(29)21-17-8-9-27(12-14-4-2-1-3-5-14)13-20(17)34-24(21)26-23(30)19-11-15-10-16(28(31)32)6-7-18(15)33-19/h1-7,10-11H,8-9,12-13H2,(H2,25,29)(H,26,30) |
| InChIKey | DZZUJPBPYTYVNC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|