C22H21N5O3S2 — CID 40953108
2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]ethanone (PubChem CID 40953108) has the molecular formula C22H21N5O3S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]ethanone.
| Compound Name | 2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 40953108 |
| Molecular Formula | C22H21N5O3S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[[5-[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-1-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc([C@@H]3COc4ccccc4O3)n2C)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C22H21N5O3S2/c1-13-10-15(14(2)27(13)21-23-8-9-31-21)16(28)12-32-22-25-24-20(26(22)3)19-11-29-17-6-4-5-7-18(17)30-19/h4-10,19H,11-12H2,1-3H3/t19-/m0/s1 |
| InChIKey | NSBMOAOQBPEPGD-IBGZPJMESA-N |
| XLogP | 4.17 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |