C24H20Cl2N2O3 — CID 40955065
(5S,10bS)-2-(2,4-dichlorophenyl)-5-(3,4-dimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 40955065) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is (5S,10bS)-2-(2,4-dichlorophenyl)-5-(3,4-dimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bS)-2-(2,4-dichlorophenyl)-5-(3,4-dimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 40955065 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (5S,10bS)-2-(2,4-dichlorophenyl)-5-(3,4-dimethoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | COc1ccc([C@@H]2Oc3ccccc3[C@@H]3CC(c4ccc(Cl)cc4Cl)=NN32)cc1OC |
| InChI | InChI=1S/C24H20Cl2N2O3/c1-29-22-10-7-14(11-23(22)30-2)24-28-20(17-5-3-4-6-21(17)31-24)13-19(27-28)16-9-8-15(25)12-18(16)26/h3-12,20,24H,13H2,1-2H3/t20-,24-/m0/s1 |
| InChIKey | WPAOKOMFKMDDMY-RDPSFJRHSA-N |
| XLogP | 6.25 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |