C31H26N2O6 — CID 40955817
6-[(5S,10bS)-2-(4-phenoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid (PubChem CID 40955817) has the molecular formula C31H26N2O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is 6-[(5S,10bS)-2-(4-phenoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(5S,10bS)-2-(4-phenoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 40955817 |
| Molecular Formula | C31H26N2O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 6-[(5S,10bS)-2-(4-phenoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc([C@@H]2Oc3ccccc3[C@@H]3CC(c4ccc(Oc5ccccc5)cc4)=NN32)c(C(=O)O)c1OC |
| InChI | InChI=1S/C31H26N2O6/c1-36-27-17-16-23(28(31(34)35)29(27)37-2)30-33-25(22-10-6-7-11-26(22)39-30)18-24(32-33)19-12-14-21(15-13-19)38-20-8-4-3-5-9-20/h3-17,25,30H,18H2,1-2H3,(H,34,35)/t25-,30-/m0/s1 |
| InChIKey | ZPEJDKMCKKQZQM-QCDSWUKFSA-N |
| XLogP | 6.44 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |