About 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine
4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 4095609) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 4095609 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCC1CSC(N(C)C)=N1 |
| InChI | InChI=1S/C9H18N2S/c1-4-5-6-8-7-12-9(10-8)11(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | HKKWJQQLAACQCG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (CID 4095609) is 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is CCCCC1CSC(N(C)C)=N1.
What is the InChIKey of 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is HKKWJQQLAACQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-4-5-6-8-7-12-9(10-8)11(2)3/h8H,4-7H2,1-3H3.
What are the key properties of 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 186.32 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-N,N-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 4095609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).