C7H14N2O — CID 4095611
N,N,4,4-tetramethyl-5H-1,3-oxazol-2-amine (PubChem CID 4095611) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is N,N,4,4-tetramethyl-5H-1,3-oxazol-2-amine.
| Compound Name | N,N,4,4-tetramethyl-5H-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 4095611 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | N,N,4,4-tetramethyl-5H-1,3-oxazol-2-amine |
| SMILES | CN(C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C7H14N2O/c1-7(2)5-10-6(8-7)9(3)4/h5H2,1-4H3 |
| InChIKey | OTCFUOZKZRXYRY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |