C13H12Cl2N4OS — CID 40956409
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[(1R)-2,2-dichlorocyclopropyl]phenyl]ethanone (PubChem CID 40956409) has the molecular formula C13H12Cl2N4OS and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[(1R)-2,2-dichlorocyclopropyl]phenyl]ethanone.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[(1R)-2,2-dichlorocyclopropyl]phenyl]ethanone |
|---|---|
| PubChem CID | 40956409 |
| Molecular Formula | C13H12Cl2N4OS |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[(1R)-2,2-dichlorocyclopropyl]phenyl]ethanone |
| SMILES | Nc1nc(SCC(=O)c2ccc([C@H]3CC3(Cl)Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C13H12Cl2N4OS/c14-13(15)5-9(13)7-1-3-8(4-2-7)10(20)6-21-12-17-11(16)18-19-12/h1-4,9H,5-6H2,(H3,16,17,18,19)/t9-/m1/s1 |
| InChIKey | YZJKFJKYEFAOOY-SECBINFHSA-N |
| XLogP | 3.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|