C18H18F3N3S — CID 4095865
N-(3,5-difluorophenyl)-3-[(4-fluorophenyl)methyl]-1,3-diazinane-1-carbothioamide (PubChem CID 4095865) has the molecular formula C18H18F3N3S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-[(4-fluorophenyl)methyl]-1,3-diazinane-1-carbothioamide.
| Compound Name | N-(3,5-difluorophenyl)-3-[(4-fluorophenyl)methyl]-1,3-diazinane-1-carbothioamide |
|---|---|
| PubChem CID | 4095865 |
| Molecular Formula | C18H18F3N3S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-[(4-fluorophenyl)methyl]-1,3-diazinane-1-carbothioamide |
| SMILES | Fc1ccc(CN2CCCN(C(=S)Nc3cc(F)cc(F)c3)C2)cc1 |
| InChI | InChI=1S/C18H18F3N3S/c19-14-4-2-13(3-5-14)11-23-6-1-7-24(12-23)18(25)22-17-9-15(20)8-16(21)10-17/h2-5,8-10H,1,6-7,11-12H2,(H,22,25) |
| InChIKey | YIJMQARSZOHNOV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|