C29H20ClN3O3 — CID 40961119
[(1S,2R,3aS)-1-benzoyl-2-(4-chlorophenyl)-3,3-dicyano-2,3a-dihydro-1H-pyrrolo[1,2-a]quinolin-7-yl] acetate (PubChem CID 40961119) has the molecular formula C29H20ClN3O3 and a molecular weight of 493.95 g/mol. Its IUPAC name is [(1S,2R,3aS)-1-benzoyl-2-(4-chlorophenyl)-3,3-dicyano-2,3a-dihydro-1H-pyrrolo[1,2-a]quinolin-7-yl] acetate.
| Compound Name | [(1S,2R,3aS)-1-benzoyl-2-(4-chlorophenyl)-3,3-dicyano-2,3a-dihydro-1H-pyrrolo[1,2-a]quinolin-7-yl] acetate |
|---|---|
| PubChem CID | 40961119 |
| Molecular Formula | C29H20ClN3O3 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [(1S,2R,3aS)-1-benzoyl-2-(4-chlorophenyl)-3,3-dicyano-2,3a-dihydro-1H-pyrrolo[1,2-a]quinolin-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C=C[C@@H]1N2[C@H](C(=O)c2ccccc2)[C@H](c2ccc(Cl)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C29H20ClN3O3/c1-18(34)36-23-12-13-24-21(15-23)9-14-25-29(16-31,17-32)26(19-7-10-22(30)11-8-19)27(33(24)25)28(35)20-5-3-2-4-6-20/h2-15,25-27H,1H3/t25-,26-,27-/m0/s1 |
| InChIKey | KVNCIODQLNZVJQ-QKDODKLFSA-N |
| XLogP | 5.55 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|