C28H43NO3 — CID 40962506
methyl (1R,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[2-[2-[[(2S)-2-methylpiperidin-1-yl]methyl]furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 40962506) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is methyl (1R,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[2-[2-[[(2S)-2-methylpiperidin-1-yl]methyl]furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[2-[2-[[(2S)-2-methylpiperidin-1-yl]methyl]furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 40962506 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | methyl (1R,4aR,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[2-[2-[[(2S)-2-methylpiperidin-1-yl]methyl]furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@@]2(C)C(=O)OC)[C@H]1CCc1ccoc1CN1CCCC[C@@H]1C |
| InChI | InChI=1S/C28H43NO3/c1-20-10-13-25-27(3,15-8-16-28(25,4)26(30)31-5)23(20)12-11-22-14-18-32-24(22)19-29-17-7-6-9-21(29)2/h14,18,21,23,25H,1,6-13,15-17,19H2,2-5H3/t21-,23-,25+,27+,28+/m0/s1 |
| InChIKey | KXDYHZVEOJTNPL-VALHTMQASA-N |
| XLogP | 6.54 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|