About 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol
3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol (PubChem CID 4096565) has the molecular formula C20H22N2O2S
and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol |
| PubChem CID | 4096565 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol |
| SMILES | CCSc1nc(-c2ccccc2)c(-c2ccccc2)n1CC(O)CO |
| InChI | InChI=1S/C20H22N2O2S/c1-2-25-20-21-18(15-9-5-3-6-10-15)19(16-11-7-4-8-12-16)22(20)13-17(24)14-23/h3-12,17,23-24H,2,13-14H2,1H3 |
| InChIKey | OYTJAOJMSXMYPC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol?
The IUPAC name of 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol (CID 4096565) is 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol.
What is the SMILES notation for 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol?
The canonical SMILES for 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol is CCSc1nc(-c2ccccc2)c(-c2ccccc2)n1CC(O)CO.
What is the InChIKey of 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol?
The InChIKey is OYTJAOJMSXMYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2S/c1-2-25-20-21-18(15-9-5-3-6-10-15)19(16-11-7-4-8-12-16)22(20)13-17(24)14-23/h3-12,17,23-24H,2,13-14H2,1H3.
What are the key properties of 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol?
3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol has a molecular weight of 354.48 g/mol, XLogP of 3.68, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylsulfanyl-4,5-diphenylimidazol-1-yl)propane-1,2-diol is sourced from PubChem (CID 4096565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).