C31H23N5O2 — CID 40969133
(E)-1-phenyl-N-[[(2R)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]ethanimine (PubChem CID 40969133) has the molecular formula C31H23N5O2 and a molecular weight of 497.56 g/mol. Its IUPAC name is (E)-1-phenyl-N-[[(2R)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]ethanimine.
| Compound Name | (E)-1-phenyl-N-[[(2R)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]ethanimine |
|---|---|
| PubChem CID | 40969133 |
| Molecular Formula | C31H23N5O2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (E)-1-phenyl-N-[[(2R)-2-phenyl-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]ethanimine |
| SMILES | C/C(=N\OCc1nc2c3c(ncn2n1)Oc1ccc2ccccc2c1[C@H]3c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H23N5O2/c1-20(21-10-4-2-5-11-21)35-37-18-26-33-30-29-27(23-13-6-3-7-14-23)28-24-15-9-8-12-22(24)16-17-25(28)38-31(29)32-19-36(30)34-26/h2-17,19,27H,18H2,1H3/b35-20+/t27-/m1/s1 |
| InChIKey | QLBJJLPMDNTPFE-OATUGGLUSA-N |
| XLogP | 6.50 |
| TPSA | 73.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|