C14H16FN5O2S — CID 40969712
4-fluoro-N'-[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 40969712) has the molecular formula C14H16FN5O2S and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-fluoro-N'-[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 40969712 |
| Molecular Formula | C14H16FN5O2S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-fluoro-N'-[2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | CC(C)n1cnnc1SCC(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FN5O2S/c1-9(2)20-8-16-19-14(20)23-7-12(21)17-18-13(22)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | LDGYUAUNQJSVQC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|