C35H30ClFN4O8 — CID 4096993
6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4096993) has the molecular formula C35H30ClFN4O8 and a molecular weight of 689.10 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4096993 |
| Molecular Formula | C35H30ClFN4O8 |
| Molecular Weight | 689.10 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-6-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C32c2ccc(Cl)cc2)cc(OC)c1O |
| InChI | InChI=1S/C35H30ClFN4O8/c1-48-25-13-16(14-26(49-2)29(25)42)28-21-11-12-22-27(32(45)40(30(22)43)34(38)47)23(21)15-24-31(44)41(39-20-9-7-19(37)8-10-20)33(46)35(24,28)17-3-5-18(36)6-4-17/h3-11,13-14,22-24,27-28,39,42H,12,15H2,1-2H3,(H2,38,47) |
| InChIKey | QICAMUSZGNRAOP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.10 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|