C16H26N4O3S2 — CID 40972624
(2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide (PubChem CID 40972624) has the molecular formula C16H26N4O3S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide.
| Compound Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 40972624 |
| Molecular Formula | C16H26N4O3S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)propanamide |
| SMILES | CCN(C(=O)[C@@H](C)Sc1nnc2n1CCCCC2)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H26N4O3S2/c1-3-19(13-8-10-25(22,23)11-13)15(21)12(2)24-16-18-17-14-7-5-4-6-9-20(14)16/h12-13H,3-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | AJJDPPJFXSDHAY-CHWSQXEVSA-N |
| XLogP | 1.52 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |