C23H30FN5O2S — CID 40972786
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 40972786) has the molecular formula C23H30FN5O2S and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 40972786 |
| Molecular Formula | C23H30FN5O2S |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(N2CCOCC2)n1-c1cccc(F)c1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H30FN5O2S/c24-18-7-3-8-19(15-18)29-22(27-11-13-31-14-12-27)25-26-23(29)32-16-21(30)28-10-4-6-17-5-1-2-9-20(17)28/h3,7-8,15,17,20H,1-2,4-6,9-14,16H2/t17-,20-/m1/s1 |
| InChIKey | FMVLXAKHWYTPGF-YLJYHZDGSA-N |
| XLogP | 3.52 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |