C26H26ClN3O2S2 — CID 40977013
2-[[(4bR,8aS)-3-(3-methylphenyl)-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 40977013) has the molecular formula C26H26ClN3O2S2 and a molecular weight of 512.10 g/mol. Its IUPAC name is 2-[[(4bR,8aS)-3-(3-methylphenyl)-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[[(4bR,8aS)-3-(3-methylphenyl)-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 40977013 |
| Molecular Formula | C26H26ClN3O2S2 |
| Molecular Weight | 512.10 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 2-[[(4bR,8aS)-3-(3-methylphenyl)-4-oxo-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1cccc(-n2c(SCC(=O)Nc3ccc(C)c(Cl)c3)nc3c(c2=O)[C@H]2CCCC[C@@H]2S3)c1 |
| InChI | InChI=1S/C26H26ClN3O2S2/c1-15-6-5-7-18(12-15)30-25(32)23-19-8-3-4-9-21(19)34-24(23)29-26(30)33-14-22(31)28-17-11-10-16(2)20(27)13-17/h5-7,10-13,19,21H,3-4,8-9,14H2,1-2H3,(H,28,31)/t19-,21-/m0/s1 |
| InChIKey | CXIZZUAIKKOARU-FPOVZHCZSA-N |
| XLogP | 6.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.10 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |