C23H21ClFN3O3 — CID 40977359
(1R,3S,3aR,6aS)-7'-chloro-5-[(4-fluorophenyl)methyl]-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 40977359) has the molecular formula C23H21ClFN3O3 and a molecular weight of 441.89 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-7'-chloro-5-[(4-fluorophenyl)methyl]-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-7'-chloro-5-[(4-fluorophenyl)methyl]-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 40977359 |
| Molecular Formula | C23H21ClFN3O3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (1R,3S,3aR,6aS)-7'-chloro-5-[(4-fluorophenyl)methyl]-1-propan-2-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CC(C)[C@H]1N[C@@]2(C(=O)Nc3c(Cl)cccc32)[C@@H]2C(=O)N(Cc3ccc(F)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H21ClFN3O3/c1-11(2)18-16-17(21(30)28(20(16)29)10-12-6-8-13(25)9-7-12)23(27-18)14-4-3-5-15(24)19(14)26-22(23)31/h3-9,11,16-18,27H,10H2,1-2H3,(H,26,31)/t16-,17-,18+,23+/m0/s1 |
| InChIKey | CERVQWSURWLYBL-VOLVWJTLSA-N |
| XLogP | 3.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|