C27H26N2O7 — CID 40977878
ethyl (3R,7'R)-2'-amino-7'-(3,4-dimethoxyphenyl)-2,5'-dioxospiro[1H-indole-3,4'-7,8-dihydro-6H-chromene]-3'-carboxylate (PubChem CID 40977878) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is ethyl (3R,7'R)-2'-amino-7'-(3,4-dimethoxyphenyl)-2,5'-dioxospiro[1H-indole-3,4'-7,8-dihydro-6H-chromene]-3'-carboxylate.
| Compound Name | ethyl (3R,7'R)-2'-amino-7'-(3,4-dimethoxyphenyl)-2,5'-dioxospiro[1H-indole-3,4'-7,8-dihydro-6H-chromene]-3'-carboxylate |
|---|---|
| PubChem CID | 40977878 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl (3R,7'R)-2'-amino-7'-(3,4-dimethoxyphenyl)-2,5'-dioxospiro[1H-indole-3,4'-7,8-dihydro-6H-chromene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)OC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C27H26N2O7/c1-4-35-25(31)23-24(28)36-21-13-15(14-9-10-19(33-2)20(12-14)34-3)11-18(30)22(21)27(23)16-7-5-6-8-17(16)29-26(27)32/h5-10,12,15H,4,11,13,28H2,1-3H3,(H,29,32)/t15-,27+/m0/s1 |
| InChIKey | BUPYECCNEBEBNK-KUNJGFBQSA-N |
| XLogP | 3.06 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |