About pentanimidamide
pentanimidamide (PubChem CID 4097830) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is pentanimidamide.
Molecular Properties
| Compound Name | pentanimidamide |
| PubChem CID | 4097830 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | pentanimidamide |
| SMILES | [H]/N=C(/N)CCCC |
| InChI | InChI=1S/C5H12N2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H3,6,7) |
| InChIKey | LPXCHPSTROLSJX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze pentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanimidamide?
The IUPAC name of pentanimidamide (CID 4097830) is pentanimidamide.
What is the SMILES notation for pentanimidamide?
The canonical SMILES for pentanimidamide is [H]/N=C(/N)CCCC.
What is the InChIKey of pentanimidamide?
The InChIKey is LPXCHPSTROLSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H3,6,7).
What are the key properties of pentanimidamide?
pentanimidamide has a molecular weight of 100.16 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanimidamide is sourced from PubChem (CID 4097830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).