C18H17ClN2O3 — CID 40978595
(2R)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-methylphenyl)propanamide (PubChem CID 40978595) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is (2R)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-methylphenyl)propanamide.
| Compound Name | (2R)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 40978595 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (2R)-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)N2C(=O)COc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-11-3-6-14(7-4-11)20-18(23)12(2)21-15-9-13(19)5-8-16(15)24-10-17(21)22/h3-9,12H,10H2,1-2H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | NEXYHGBQMUULQG-GFCCVEGCSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |