C19H36N4O4S — CID 4097871
1-(4-methylpiperidin-1-yl)sulfonyl-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide (PubChem CID 4097871) has the molecular formula C19H36N4O4S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)sulfonyl-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-methylpiperidin-1-yl)sulfonyl-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 4097871 |
| Molecular Formula | C19H36N4O4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)sulfonyl-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)N2CCCC(C(=O)NCCCN3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C19H36N4O4S/c1-17-5-10-22(11-6-17)28(25,26)23-9-2-4-18(16-23)19(24)20-7-3-8-21-12-14-27-15-13-21/h17-18H,2-16H2,1H3,(H,20,24) |
| InChIKey | XRZCHLNWYRWMKK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|