C18H20N2O3 — CID 40978744
N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(1R)-1-phenylethyl]oxamide (PubChem CID 40978744) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 40978744 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylethyl]-N'-[(1R)-1-phenylethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NC[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-13(14-8-4-2-5-9-14)20-18(23)17(22)19-12-16(21)15-10-6-3-7-11-15/h2-11,13,16,21H,12H2,1H3,(H,19,22)(H,20,23)/t13-,16+/m1/s1 |
| InChIKey | APZZBIDTQZSQQQ-CJNGLKHVSA-N |
| XLogP | 1.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|