C25H23N5OS — CID 40980517
(6R,7S)-N-(2-ethylphenyl)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 40980517) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is (6R,7S)-N-(2-ethylphenyl)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6R,7S)-N-(2-ethylphenyl)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 40980517 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (6R,7S)-N-(2-ethylphenyl)-3,6-diphenyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCc1ccccc1NC(=O)[C@H]1Sc2nnc(-c3ccccc3)n2N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23N5OS/c1-2-17-11-9-10-16-20(17)26-24(31)22-21(18-12-5-3-6-13-18)29-30-23(27-28-25(30)32-22)19-14-7-4-8-15-19/h3-16,21-22,29H,2H2,1H3,(H,26,31)/t21-,22+/m1/s1 |
| InChIKey | VQQKSLZENUGXGR-YADHBBJMSA-N |
| XLogP | 4.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |